C8H10N2O2 — CID 66936241
(4aR)-1,4,4a,5,6,7-hexahydroquinoxaline-2,3-dione (PubChem CID 66936241) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is (4aR)-1,4,4a,5,6,7-hexahydroquinoxaline-2,3-dione.
| Compound Name | (4aR)-1,4,4a,5,6,7-hexahydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 66936241 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | (4aR)-1,4,4a,5,6,7-hexahydroquinoxaline-2,3-dione |
| SMILES | O=C1NC2=CCCC[C@H]2NC1=O |
| InChI | InChI=1S/C8H10N2O2/c11-7-8(12)10-6-4-2-1-3-5(6)9-7/h3,6H,1-2,4H2,(H,9,11)(H,10,12)/t6-/m1/s1 |
| InChIKey | LTOWSJSGYSRKDE-ZCFIWIBFSA-N |
| XLogP | -0.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|