C8H16N2O — CID 66936245
(3R,4R)-N,N,4-trimethylpyrrolidine-3-carboxamide (PubChem CID 66936245) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is (3R,4R)-N,N,4-trimethylpyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-N,N,4-trimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 66936245 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (3R,4R)-N,N,4-trimethylpyrrolidine-3-carboxamide |
| SMILES | C[C@H]1CNC[C@@H]1C(=O)N(C)C |
| InChI | InChI=1S/C8H16N2O/c1-6-4-9-5-7(6)8(11)10(2)3/h6-7,9H,4-5H2,1-3H3/t6-,7-/m0/s1 |
| InChIKey | PYXAXGUAZSRECA-BQBZGAKWSA-N |
| XLogP | -0.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |