C11H22N2O2 — CID 66936309
(3S)-2-tert-butyl-3,4-dimethylpiperazine-1-carboxylic acid (PubChem CID 66936309) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (3S)-2-tert-butyl-3,4-dimethylpiperazine-1-carboxylic acid.
| Compound Name | (3S)-2-tert-butyl-3,4-dimethylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 66936309 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (3S)-2-tert-butyl-3,4-dimethylpiperazine-1-carboxylic acid |
| SMILES | C[C@H]1C(C(C)(C)C)N(C(=O)O)CCN1C |
| InChI | InChI=1S/C11H22N2O2/c1-8-9(11(2,3)4)13(10(14)15)7-6-12(8)5/h8-9H,6-7H2,1-5H3,(H,14,15)/t8-,9?/m0/s1 |
| InChIKey | CJKSFYCMYJNHFR-IENPIDJESA-N |
| XLogP | 1.72 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |