About 4-hydroxy-3,5-bis(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one
4-hydroxy-3,5-bis(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one (PubChem CID 66936310) has the molecular formula C19H13NO4S
and a molecular weight of 351.38 g/mol. Its IUPAC name is 4-hydroxy-3,5-bis(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one.
Molecular Properties
| Compound Name | 4-hydroxy-3,5-bis(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one |
| PubChem CID | 66936310 |
| Molecular Formula | C19H13NO4S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 4-hydroxy-3,5-bis(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one |
| SMILES | O=c1[nH]c2scc(-c3ccc(O)cc3)c2c(O)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C19H13NO4S/c21-12-5-1-10(2-6-12)14-9-25-19-16(14)17(23)15(18(24)20-19)11-3-7-13(22)8-4-11/h1-9,21-22H,(H2,20,23,24) |
| InChIKey | BWRHIIFWMSQOKZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-hydroxy-3,5-bis(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3,5-bis(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one?
The IUPAC name of 4-hydroxy-3,5-bis(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one (CID 66936310) is 4-hydroxy-3,5-bis(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one.
What is the SMILES notation for 4-hydroxy-3,5-bis(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one?
The canonical SMILES for 4-hydroxy-3,5-bis(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one is O=c1[nH]c2scc(-c3ccc(O)cc3)c2c(O)c1-c1ccc(O)cc1.
What is the InChIKey of 4-hydroxy-3,5-bis(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one?
The InChIKey is BWRHIIFWMSQOKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NO4S/c21-12-5-1-10(2-6-12)14-9-25-19-16(14)17(23)15(18(24)20-19)11-3-7-13(22)8-4-11/h1-9,21-22H,(H2,20,23,24).
What are the key properties of 4-hydroxy-3,5-bis(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one?
4-hydroxy-3,5-bis(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one has a molecular weight of 351.38 g/mol, XLogP of 4.04, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3,5-bis(4-hydroxyphenyl)-7H-thieno[2,3-b]pyridin-6-one is sourced from PubChem (CID 66936310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).