About 4-methyl-4,7-diazaspiro[2.5]octane-5,8-dione
4-methyl-4,7-diazaspiro[2.5]octane-5,8-dione (PubChem CID 66936393) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 4-methyl-4,7-diazaspiro[2.5]octane-5,8-dione.
Molecular Properties
| Compound Name | 4-methyl-4,7-diazaspiro[2.5]octane-5,8-dione |
| PubChem CID | 66936393 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 4-methyl-4,7-diazaspiro[2.5]octane-5,8-dione |
| SMILES | CN1C(=O)CNC(=O)C12CC2 |
| InChI | InChI=1S/C7H10N2O2/c1-9-5(10)4-8-6(11)7(9)2-3-7/h2-4H2,1H3,(H,8,11) |
| InChIKey | RPCMHQVORGIYMF-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-4,7-diazaspiro[2.5]octane-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4,7-diazaspiro[2.5]octane-5,8-dione?
The IUPAC name of 4-methyl-4,7-diazaspiro[2.5]octane-5,8-dione (CID 66936393) is 4-methyl-4,7-diazaspiro[2.5]octane-5,8-dione.
What is the SMILES notation for 4-methyl-4,7-diazaspiro[2.5]octane-5,8-dione?
The canonical SMILES for 4-methyl-4,7-diazaspiro[2.5]octane-5,8-dione is CN1C(=O)CNC(=O)C12CC2.
What is the InChIKey of 4-methyl-4,7-diazaspiro[2.5]octane-5,8-dione?
The InChIKey is RPCMHQVORGIYMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-9-5(10)4-8-6(11)7(9)2-3-7/h2-4H2,1H3,(H,8,11).
What are the key properties of 4-methyl-4,7-diazaspiro[2.5]octane-5,8-dione?
4-methyl-4,7-diazaspiro[2.5]octane-5,8-dione has a molecular weight of 154.17 g/mol, XLogP of -0.89, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4,7-diazaspiro[2.5]octane-5,8-dione is sourced from PubChem (CID 66936393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).