About 5-methyl-1,2,3,6-tetrahydropyrido[2,3-b][1,4]oxazine
5-methyl-1,2,3,6-tetrahydropyrido[2,3-b][1,4]oxazine (PubChem CID 66936529) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 5-methyl-1,2,3,6-tetrahydropyrido[2,3-b][1,4]oxazine.
Analyze 5-methyl-1,2,3,6-tetrahydropyrido[2,3-b][1,4]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,2,3,6-tetrahydropyrido[2,3-b][1,4]oxazine?
The IUPAC name of 5-methyl-1,2,3,6-tetrahydropyrido[2,3-b][1,4]oxazine (CID 66936529) is 5-methyl-1,2,3,6-tetrahydropyrido[2,3-b][1,4]oxazine.
What is the SMILES notation for 5-methyl-1,2,3,6-tetrahydropyrido[2,3-b][1,4]oxazine?
The canonical SMILES for 5-methyl-1,2,3,6-tetrahydropyrido[2,3-b][1,4]oxazine is CN1CC=CC2=C1OCCN2.
What is the InChIKey of 5-methyl-1,2,3,6-tetrahydropyrido[2,3-b][1,4]oxazine?
The InChIKey is CFSYPKNUNIPJJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-10-5-2-3-7-8(10)11-6-4-9-7/h2-3,9H,4-6H2,1H3.
What are the key properties of 5-methyl-1,2,3,6-tetrahydropyrido[2,3-b][1,4]oxazine?
5-methyl-1,2,3,6-tetrahydropyrido[2,3-b][1,4]oxazine has a molecular weight of 152.20 g/mol, XLogP of 0.28, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,2,3,6-tetrahydropyrido[2,3-b][1,4]oxazine is sourced from PubChem (CID 66936529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).