About [(3R,4R)-4-methylpyrrolidin-3-yl]methanol
[(3R,4R)-4-methylpyrrolidin-3-yl]methanol (PubChem CID 66936601) has the molecular formula C12H26N2O2
and a molecular weight of 230.35 g/mol. Its IUPAC name is [(3R,4R)-4-methylpyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R,4R)-4-methylpyrrolidin-3-yl]methanol |
| PubChem CID | 66936601 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | [(3R,4R)-4-methylpyrrolidin-3-yl]methanol |
| SMILES | C[C@H]1CNC[C@@H]1CO.C[C@H]1CNC[C@@H]1CO |
| InChI | InChI=1S/2C6H13NO/c2*1-5-2-7-3-6(5)4-8/h2*5-8H,2-4H2,1H3/t2*5-,6+/m00/s1 |
| InChIKey | AKSKTWKPMVVWCR-HMOFGSSPSA-N |
| XLogP | -0.33 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3R,4R)-4-methylpyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-4-methylpyrrolidin-3-yl]methanol?
The IUPAC name of [(3R,4R)-4-methylpyrrolidin-3-yl]methanol (CID 66936601) is [(3R,4R)-4-methylpyrrolidin-3-yl]methanol.
What is the SMILES notation for [(3R,4R)-4-methylpyrrolidin-3-yl]methanol?
The canonical SMILES for [(3R,4R)-4-methylpyrrolidin-3-yl]methanol is C[C@H]1CNC[C@@H]1CO.C[C@H]1CNC[C@@H]1CO.
What is the InChIKey of [(3R,4R)-4-methylpyrrolidin-3-yl]methanol?
The InChIKey is AKSKTWKPMVVWCR-HMOFGSSPSA-N. The full InChI is InChI=1S/2C6H13NO/c2*1-5-2-7-3-6(5)4-8/h2*5-8H,2-4H2,1H3/t2*5-,6+/m00/s1.
What are the key properties of [(3R,4R)-4-methylpyrrolidin-3-yl]methanol?
[(3R,4R)-4-methylpyrrolidin-3-yl]methanol has a molecular weight of 230.35 g/mol, XLogP of -0.33, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-4-methylpyrrolidin-3-yl]methanol is sourced from PubChem (CID 66936601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).