C15H13N3O — CID 66936733
7-(1H-indol-4-yl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine (PubChem CID 66936733) has the molecular formula C15H13N3O and a molecular weight of 251.29 g/mol. Its IUPAC name is 7-(1H-indol-4-yl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine.
| Compound Name | 7-(1H-indol-4-yl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine |
|---|---|
| PubChem CID | 66936733 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 7-(1H-indol-4-yl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine |
| SMILES | c1cc(-c2cnc3c(c2)NCCO3)c2cc[nH]c2c1 |
| InChI | InChI=1S/C15H13N3O/c1-2-11(12-4-5-16-13(12)3-1)10-8-14-15(18-9-10)19-7-6-17-14/h1-5,8-9,16-17H,6-7H2 |
| InChIKey | SDQLTHGIMKNDGZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |