About (2R,6S)-4-(methoxymethylidene)-2,6-dimethyloxane
(2R,6S)-4-(methoxymethylidene)-2,6-dimethyloxane (PubChem CID 66936926) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is (2R,6S)-4-(methoxymethylidene)-2,6-dimethyloxane.
Molecular Properties
| Compound Name | (2R,6S)-4-(methoxymethylidene)-2,6-dimethyloxane |
| PubChem CID | 66936926 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (2R,6S)-4-(methoxymethylidene)-2,6-dimethyloxane |
| SMILES | CO/C=C1\C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C9H16O2/c1-7-4-9(6-10-3)5-8(2)11-7/h6-8H,4-5H2,1-3H3/b9-6-/t7-,8+/m0/s1 |
| InChIKey | YMMBLSMXZZFWKV-GCICIJSESA-N |
| XLogP | 2.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (2R,6S)-4-(methoxymethylidene)-2,6-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-4-(methoxymethylidene)-2,6-dimethyloxane?
The IUPAC name of (2R,6S)-4-(methoxymethylidene)-2,6-dimethyloxane (CID 66936926) is (2R,6S)-4-(methoxymethylidene)-2,6-dimethyloxane.
What is the SMILES notation for (2R,6S)-4-(methoxymethylidene)-2,6-dimethyloxane?
The canonical SMILES for (2R,6S)-4-(methoxymethylidene)-2,6-dimethyloxane is CO/C=C1\C[C@@H](C)O[C@@H](C)C1.
What is the InChIKey of (2R,6S)-4-(methoxymethylidene)-2,6-dimethyloxane?
The InChIKey is YMMBLSMXZZFWKV-GCICIJSESA-N. The full InChI is InChI=1S/C9H16O2/c1-7-4-9(6-10-3)5-8(2)11-7/h6-8H,4-5H2,1-3H3/b9-6-/t7-,8+/m0/s1.
What are the key properties of (2R,6S)-4-(methoxymethylidene)-2,6-dimethyloxane?
(2R,6S)-4-(methoxymethylidene)-2,6-dimethyloxane has a molecular weight of 156.22 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-4-(methoxymethylidene)-2,6-dimethyloxane is sourced from PubChem (CID 66936926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).