C15H21ClIN3O2 — CID 66936969
tert-butyl 4-[(5-chloro-4-iodo-2-pyridinyl)amino]piperidine-1-carboxylate (PubChem CID 66936969) has the molecular formula C15H21ClIN3O2 and a molecular weight of 437.71 g/mol. Its IUPAC name is tert-butyl 4-[(5-chloro-4-iodo-2-pyridinyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(5-chloro-4-iodo-2-pyridinyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66936969 |
| Molecular Formula | C15H21ClIN3O2 |
| Molecular Weight | 437.71 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | tert-butyl 4-[(5-chloro-4-iodo-2-pyridinyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cc(I)c(Cl)cn2)CC1 |
| InChI | InChI=1S/C15H21ClIN3O2/c1-15(2,3)22-14(21)20-6-4-10(5-7-20)19-13-8-12(17)11(16)9-18-13/h8-10H,4-7H2,1-3H3,(H,18,19) |
| InChIKey | WVDAIQRWMQQRPG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.71 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|