C20H36O4 — CID 66937614
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,2-diol;3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalene-1,1-diol (PubChem CID 66937614) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,2-diol;3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalene-1,1-diol.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,2-diol;3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalene-1,1-diol |
|---|---|
| PubChem CID | 66937614 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,2-diol;3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalene-1,1-diol |
| SMILES | OC1(O)CCCC2CCCCC21.OC1CCC2CCCCC2C1O |
| InChI | InChI=1S/2C10H18O2/c11-10(12)7-3-5-8-4-1-2-6-9(8)10;11-9-6-5-7-3-1-2-4-8(7)10(9)12/h8-9,11-12H,1-7H2;7-12H,1-6H2 |
| InChIKey | XYDVRBBCICGJJU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|