C22H28F2N6O4 — CID 66937850
tert-butyl (3S)-3-[[[2-[(3,4-difluorophenyl)methylamino]-5-nitropyrimidin-4-yl]amino]methyl]piperidine-1-carboxylate (PubChem CID 66937850) has the molecular formula C22H28F2N6O4 and a molecular weight of 478.50 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[[2-[(3,4-difluorophenyl)methylamino]-5-nitropyrimidin-4-yl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[[2-[(3,4-difluorophenyl)methylamino]-5-nitropyrimidin-4-yl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66937850 |
| Molecular Formula | C22H28F2N6O4 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | tert-butyl (3S)-3-[[[2-[(3,4-difluorophenyl)methylamino]-5-nitropyrimidin-4-yl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](CNc2nc(NCc3ccc(F)c(F)c3)ncc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C22H28F2N6O4/c1-22(2,3)34-21(31)29-8-4-5-15(13-29)11-25-19-18(30(32)33)12-27-20(28-19)26-10-14-6-7-16(23)17(24)9-14/h6-7,9,12,15H,4-5,8,10-11,13H2,1-3H3,(H2,25,26,27,28)/t15-/m0/s1 |
| InChIKey | LEUNNHLGEHSKSC-HNNXBMFYSA-N |
| XLogP | 4.33 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|