C25H44O7Si — CID 66937942
[(2S,3S,4E,6S,7R,10R)-7-hydroxy-2-[(E)-4-hydroxybut-2-en-2-yl]-3,7-dimethyl-12-oxo-10-triethylsilyloxy-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 66937942) has the molecular formula C25H44O7Si and a molecular weight of 484.71 g/mol. Its IUPAC name is [(2S,3S,4E,6S,7R,10R)-7-hydroxy-2-[(E)-4-hydroxybut-2-en-2-yl]-3,7-dimethyl-12-oxo-10-triethylsilyloxy-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(2S,3S,4E,6S,7R,10R)-7-hydroxy-2-[(E)-4-hydroxybut-2-en-2-yl]-3,7-dimethyl-12-oxo-10-triethylsilyloxy-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 66937942 |
| Molecular Formula | C25H44O7Si |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | [(2S,3S,4E,6S,7R,10R)-7-hydroxy-2-[(E)-4-hydroxybut-2-en-2-yl]-3,7-dimethyl-12-oxo-10-triethylsilyloxy-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CC[Si](CC)(CC)O[C@@H]1CC[C@@](C)(O)[C@@H](OC(C)=O)/C=C/[C@H](C)[C@@H](/C(C)=C/CO)OC(=O)C1 |
| InChI | InChI=1S/C25H44O7Si/c1-8-33(9-2,10-3)32-21-13-15-25(7,29)22(30-20(6)27)12-11-18(4)24(19(5)14-16-26)31-23(28)17-21/h11-12,14,18,21-22,24,26,29H,8-10,13,15-17H2,1-7H3/b12-11+,19-14+/t18-,21+,22-,24-,25+/m0/s1 |
| InChIKey | HJZIBTQZCKFTII-CGUGBNQFSA-N |
| XLogP | 4.29 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|