C13H14O2 — CID 66938172
1,2,3,4,6,7-hexahydroxanthen-9-one (PubChem CID 66938172) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 1,2,3,4,6,7-hexahydroxanthen-9-one.
| Compound Name | 1,2,3,4,6,7-hexahydroxanthen-9-one |
|---|---|
| PubChem CID | 66938172 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 1,2,3,4,6,7-hexahydroxanthen-9-one |
| SMILES | O=c1c2c(oc3c1=CCCC=3)CCCC2 |
| InChI | InChI=1S/C13H14O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h5,7H,1-4,6,8H2 |
| InChIKey | NELVRKMDCNUZQD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |