C28H29Cl2N9O5 — CID 66939209
methyl N-[4-[5-chloro-2-[(1S)-1-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-3-(2-ethoxyethylamino)-3-oxopropyl]-1H-imidazol-4-yl]phenyl]carbamate (PubChem CID 66939209) has the molecular formula C28H29Cl2N9O5 and a molecular weight of 642.50 g/mol. Its IUPAC name is methyl N-[4-[5-chloro-2-[(1S)-1-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-3-(2-ethoxyethylamino)-3-oxopropyl]-1H-imidazol-4-yl]phenyl]carbamate.
| Compound Name | methyl N-[4-[5-chloro-2-[(1S)-1-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-3-(2-ethoxyethylamino)-3-oxopropyl]-1H-imidazol-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 66939209 |
| Molecular Formula | C28H29Cl2N9O5 |
| Molecular Weight | 642.50 g/mol |
| Exact Mass | 641.17 |
| IUPAC Name | methyl N-[4-[5-chloro-2-[(1S)-1-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-3-(2-ethoxyethylamino)-3-oxopropyl]-1H-imidazol-4-yl]phenyl]carbamate |
| SMILES | CCOCCNC(=O)C[C@H](NC(=O)C=Cc1cc(Cl)ccc1-n1cnnn1)c1nc(-c2ccc(NC(=O)OC)cc2)c(Cl)[nH]1 |
| InChI | InChI=1S/C28H29Cl2N9O5/c1-3-44-13-12-31-24(41)15-21(27-35-25(26(30)36-27)17-4-8-20(9-5-17)33-28(42)43-2)34-23(40)11-6-18-14-19(29)7-10-22(18)39-16-32-37-38-39/h4-11,14,16,21H,3,12-13,15H2,1-2H3,(H,31,41)(H,33,42)(H,34,40)(H,35,36)/t21-/m0/s1 |
| InChIKey | VCEWLMUDEKDPLX-NRFANRHFSA-N |
| XLogP | 3.95 |
| TPSA | 178.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|