About 2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethanol;ethanol
2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethanol;ethanol (PubChem CID 66939414) has the molecular formula C17H36O3Si
and a molecular weight of 316.56 g/mol. Its IUPAC name is 2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethanol;ethanol.
Molecular Properties
| Compound Name | 2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethanol;ethanol |
| PubChem CID | 66939414 |
| Molecular Formula | C17H36O3Si |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethanol;ethanol |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CCCC(CCO)C1.CCO |
| InChI | InChI=1S/C15H30O2Si.C2H6O/c1-15(2,3)18(4,5)17-12-14-8-6-7-13(11-14)9-10-16;1-2-3/h8,13,16H,6-7,9-12H2,1-5H3;3H,2H2,1H3 |
| InChIKey | PLIPKVOGUBEEQK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethanol;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethanol;ethanol?
The IUPAC name of 2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethanol;ethanol (CID 66939414) is 2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethanol;ethanol.
What is the SMILES notation for 2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethanol;ethanol?
The canonical SMILES for 2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethanol;ethanol is CC(C)(C)[Si](C)(C)OCC1=CCCC(CCO)C1.CCO.
What is the InChIKey of 2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethanol;ethanol?
The InChIKey is PLIPKVOGUBEEQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2Si.C2H6O/c1-15(2,3)18(4,5)17-12-14-8-6-7-13(11-14)9-10-16;1-2-3/h8,13,16H,6-7,9-12H2,1-5H3;3H,2H2,1H3.
What are the key properties of 2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethanol;ethanol?
2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethanol;ethanol has a molecular weight of 316.56 g/mol, XLogP of 4.12, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethanol;ethanol is sourced from PubChem (CID 66939414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).