C24H32F3N3O8S2 — CID 66939524
N-[2-[[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-1-azabicyclo[3.2.1]octan-8-yl]sulfonyl]ethyl]cyclopropanesulfonamide;(Z)-but-2-enedioic acid (PubChem CID 66939524) has the molecular formula C24H32F3N3O8S2 and a molecular weight of 611.66 g/mol. Its IUPAC name is N-[2-[[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-1-azabicyclo[3.2.1]octan-8-yl]sulfonyl]ethyl]cyclopropanesulfonamide;(Z)-but-2-enedioic acid.
| Compound Name | N-[2-[[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-1-azabicyclo[3.2.1]octan-8-yl]sulfonyl]ethyl]cyclopropanesulfonamide;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 66939524 |
| Molecular Formula | C24H32F3N3O8S2 |
| Molecular Weight | 611.66 g/mol |
| Exact Mass | 611.16 |
| IUPAC Name | N-[2-[[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-1-azabicyclo[3.2.1]octan-8-yl]sulfonyl]ethyl]cyclopropanesulfonamide;(Z)-but-2-enedioic acid |
| SMILES | N[C@H](Cc1cc(F)c(F)cc1F)C1CC2CCN(C1)C2S(=O)(=O)CCNS(=O)(=O)C1CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H28F3N3O4S2.C4H4O4/c21-16-10-18(23)17(22)8-13(16)9-19(24)14-7-12-3-5-26(11-14)20(12)31(27,28)6-4-25-32(29,30)15-1-2-15;5-3(6)1-2-4(7)8/h8,10,12,14-15,19-20,25H,1-7,9,11,24H2;1-2H,(H,5,6)(H,7,8)/b;2-1-/t12?,14?,19-,20?;/m1./s1 |
| InChIKey | LTWYZBZZPYOKDW-BURISRTFSA-N |
| XLogP | 0.85 |
| TPSA | 184.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.66 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|