About prop-2-enoic acid;1-thiophen-2-ylpropan-1-amine
prop-2-enoic acid;1-thiophen-2-ylpropan-1-amine (PubChem CID 66939637) has the molecular formula C10H15NO2S
and a molecular weight of 213.30 g/mol. Its IUPAC name is prop-2-enoic acid;1-thiophen-2-ylpropan-1-amine.
Molecular Properties
| Compound Name | prop-2-enoic acid;1-thiophen-2-ylpropan-1-amine |
| PubChem CID | 66939637 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | prop-2-enoic acid;1-thiophen-2-ylpropan-1-amine |
| SMILES | C=CC(=O)O.CCC(N)c1cccs1 |
| InChI | InChI=1S/C7H11NS.C3H4O2/c1-2-6(8)7-4-3-5-9-7;1-2-3(4)5/h3-6H,2,8H2,1H3;2H,1H2,(H,4,5) |
| InChIKey | PQCIMOUCLMJJHH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enoic acid;1-thiophen-2-ylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enoic acid;1-thiophen-2-ylpropan-1-amine?
The IUPAC name of prop-2-enoic acid;1-thiophen-2-ylpropan-1-amine (CID 66939637) is prop-2-enoic acid;1-thiophen-2-ylpropan-1-amine.
What is the SMILES notation for prop-2-enoic acid;1-thiophen-2-ylpropan-1-amine?
The canonical SMILES for prop-2-enoic acid;1-thiophen-2-ylpropan-1-amine is C=CC(=O)O.CCC(N)c1cccs1.
What is the InChIKey of prop-2-enoic acid;1-thiophen-2-ylpropan-1-amine?
The InChIKey is PQCIMOUCLMJJHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NS.C3H4O2/c1-2-6(8)7-4-3-5-9-7;1-2-3(4)5/h3-6H,2,8H2,1H3;2H,1H2,(H,4,5).
What are the key properties of prop-2-enoic acid;1-thiophen-2-ylpropan-1-amine?
prop-2-enoic acid;1-thiophen-2-ylpropan-1-amine has a molecular weight of 213.30 g/mol, XLogP of 2.41, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enoic acid;1-thiophen-2-ylpropan-1-amine is sourced from PubChem (CID 66939637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).