C27H50O5 — CID 66939694
bis[1-(2-hydroxypropyl)-5-methyl-2-propan-2-ylcyclohexyl] carbonate (PubChem CID 66939694) has the molecular formula C27H50O5 and a molecular weight of 454.69 g/mol. Its IUPAC name is bis[1-(2-hydroxypropyl)-5-methyl-2-propan-2-ylcyclohexyl] carbonate.
| Compound Name | bis[1-(2-hydroxypropyl)-5-methyl-2-propan-2-ylcyclohexyl] carbonate |
|---|---|
| PubChem CID | 66939694 |
| Molecular Formula | C27H50O5 |
| Molecular Weight | 454.69 g/mol |
| Exact Mass | 454.37 |
| IUPAC Name | bis[1-(2-hydroxypropyl)-5-methyl-2-propan-2-ylcyclohexyl] carbonate |
| SMILES | CC(O)CC1(OC(=O)OC2(CC(C)O)CC(C)CCC2C(C)C)CC(C)CCC1C(C)C |
| InChI | InChI=1S/C27H50O5/c1-17(2)23-11-9-19(5)13-26(23,15-21(7)28)31-25(30)32-27(16-22(8)29)14-20(6)10-12-24(27)18(3)4/h17-24,28-29H,9-16H2,1-8H3 |
| InChIKey | GRXVLHSAOYWPCK-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.69 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |