About hexan-2-yl imidazole-1-carboxylate
hexan-2-yl imidazole-1-carboxylate (PubChem CID 66939722) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is hexan-2-yl imidazole-1-carboxylate.
Molecular Properties
| Compound Name | hexan-2-yl imidazole-1-carboxylate |
| PubChem CID | 66939722 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | hexan-2-yl imidazole-1-carboxylate |
| SMILES | CCCCC(C)OC(=O)n1ccnc1 |
| InChI | InChI=1S/C10H16N2O2/c1-3-4-5-9(2)14-10(13)12-7-6-11-8-12/h6-9H,3-5H2,1-2H3 |
| InChIKey | RSEDKURYWYBGLU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze hexan-2-yl imidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-2-yl imidazole-1-carboxylate?
The IUPAC name of hexan-2-yl imidazole-1-carboxylate (CID 66939722) is hexan-2-yl imidazole-1-carboxylate.
What is the SMILES notation for hexan-2-yl imidazole-1-carboxylate?
The canonical SMILES for hexan-2-yl imidazole-1-carboxylate is CCCCC(C)OC(=O)n1ccnc1.
What is the InChIKey of hexan-2-yl imidazole-1-carboxylate?
The InChIKey is RSEDKURYWYBGLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-3-4-5-9(2)14-10(13)12-7-6-11-8-12/h6-9H,3-5H2,1-2H3.
What are the key properties of hexan-2-yl imidazole-1-carboxylate?
hexan-2-yl imidazole-1-carboxylate has a molecular weight of 196.25 g/mol, XLogP of 2.45, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-2-yl imidazole-1-carboxylate is sourced from PubChem (CID 66939722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).