C29H34F3N3O5S2 — CID 66939925
N-[(1S)-1-[(1R,5S)-8-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]-8-azabicyclo[3.2.1]octan-3-yl]-2-(2,4,5-trifluorophenyl)ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 66939925) has the molecular formula C29H34F3N3O5S2 and a molecular weight of 625.74 g/mol. Its IUPAC name is N-[(1S)-1-[(1R,5S)-8-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]-8-azabicyclo[3.2.1]octan-3-yl]-2-(2,4,5-trifluorophenyl)ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(1S)-1-[(1R,5S)-8-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]-8-azabicyclo[3.2.1]octan-3-yl]-2-(2,4,5-trifluorophenyl)ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 66939925 |
| Molecular Formula | C29H34F3N3O5S2 |
| Molecular Weight | 625.74 g/mol |
| Exact Mass | 625.19 |
| IUPAC Name | N-[(1S)-1-[(1R,5S)-8-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]-8-azabicyclo[3.2.1]octan-3-yl]-2-(2,4,5-trifluorophenyl)ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N[C@@H](Cc1cc(F)c(F)cc1F)C1C[C@H]2CC[C@@H](C1)N2S(=O)(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C29H34F3N3O5S2/c1-29(2,3)41(38)33-26(15-17-14-24(31)25(32)16-23(17)30)18-12-19-8-9-20(13-18)35(19)42(39,40)11-10-34-27(36)21-6-4-5-7-22(21)28(34)37/h4-7,14,16,18-20,26,33H,8-13,15H2,1-3H3/t18?,19-,20+,26-,41?/m0/s1 |
| InChIKey | UHXOIGAJPZGFBZ-DXUCZPFRSA-N |
| XLogP | 3.94 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.74 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|