About 4-ethoxy-N-(1,2,4-triazol-4-yl)benzamide
4-ethoxy-N-(1,2,4-triazol-4-yl)benzamide (PubChem CID 669400) has the molecular formula C11H12N4O2
and a molecular weight of 232.24 g/mol. Its IUPAC name is 4-ethoxy-N-(1,2,4-triazol-4-yl)benzamide.
Molecular Properties
| Compound Name | 4-ethoxy-N-(1,2,4-triazol-4-yl)benzamide |
| PubChem CID | 669400 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 4-ethoxy-N-(1,2,4-triazol-4-yl)benzamide |
| SMILES | CCOc1ccc(C(=O)Nn2cnnc2)cc1 |
| InChI | InChI=1S/C11H12N4O2/c1-2-17-10-5-3-9(4-6-10)11(16)14-15-7-12-13-8-15/h3-8H,2H2,1H3,(H,14,16) |
| InChIKey | UEKNOUDIMUKKPT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-ethoxy-N-(1,2,4-triazol-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-N-(1,2,4-triazol-4-yl)benzamide?
The IUPAC name of 4-ethoxy-N-(1,2,4-triazol-4-yl)benzamide (CID 669400) is 4-ethoxy-N-(1,2,4-triazol-4-yl)benzamide.
What is the SMILES notation for 4-ethoxy-N-(1,2,4-triazol-4-yl)benzamide?
The canonical SMILES for 4-ethoxy-N-(1,2,4-triazol-4-yl)benzamide is CCOc1ccc(C(=O)Nn2cnnc2)cc1.
What is the InChIKey of 4-ethoxy-N-(1,2,4-triazol-4-yl)benzamide?
The InChIKey is UEKNOUDIMUKKPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O2/c1-2-17-10-5-3-9(4-6-10)11(16)14-15-7-12-13-8-15/h3-8H,2H2,1H3,(H,14,16).
What are the key properties of 4-ethoxy-N-(1,2,4-triazol-4-yl)benzamide?
4-ethoxy-N-(1,2,4-triazol-4-yl)benzamide has a molecular weight of 232.24 g/mol, XLogP of 1.06, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-N-(1,2,4-triazol-4-yl)benzamide is sourced from PubChem (CID 669400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).