C28H38F3N3O8S — CID 66940007
N-[2-[[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]ethyl]-N-methyloxane-4-carboxamide;(Z)-but-2-enedioic acid (PubChem CID 66940007) has the molecular formula C28H38F3N3O8S and a molecular weight of 633.69 g/mol. Its IUPAC name is N-[2-[[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]ethyl]-N-methyloxane-4-carboxamide;(Z)-but-2-enedioic acid.
| Compound Name | N-[2-[[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]ethyl]-N-methyloxane-4-carboxamide;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 66940007 |
| Molecular Formula | C28H38F3N3O8S |
| Molecular Weight | 633.69 g/mol |
| Exact Mass | 633.23 |
| IUPAC Name | N-[2-[[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]ethyl]-N-methyloxane-4-carboxamide;(Z)-but-2-enedioic acid |
| SMILES | CN(CCS(=O)(=O)N1C2CCC1CC([C@H](N)Cc1cc(F)c(F)cc1F)C2)C(=O)C1CCOCC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C24H34F3N3O4S.C4H4O4/c1-29(24(31)15-4-7-34-8-5-15)6-9-35(32,33)30-18-2-3-19(30)11-17(10-18)23(28)13-16-12-21(26)22(27)14-20(16)25;5-3(6)1-2-4(7)8/h12,14-15,17-19,23H,2-11,13,28H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t17?,18?,19?,23-;/m1./s1 |
| InChIKey | AOPXOLBRPNKLSE-HSGACVMWSA-N |
| XLogP | 2.14 |
| TPSA | 167.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.69 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|