About 2-[(2,6-dimethylphenoxy)methoxy]-2-[4-(trifluoromethoxy)phenyl]acetonitrile
2-[(2,6-dimethylphenoxy)methoxy]-2-[4-(trifluoromethoxy)phenyl]acetonitrile (PubChem CID 66940058) has the molecular formula C18H16F3NO3
and a molecular weight of 351.32 g/mol. Its IUPAC name is 2-[(2,6-dimethylphenoxy)methoxy]-2-[4-(trifluoromethoxy)phenyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(2,6-dimethylphenoxy)methoxy]-2-[4-(trifluoromethoxy)phenyl]acetonitrile |
| PubChem CID | 66940058 |
| Molecular Formula | C18H16F3NO3 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2-[(2,6-dimethylphenoxy)methoxy]-2-[4-(trifluoromethoxy)phenyl]acetonitrile |
| SMILES | Cc1cccc(C)c1OCOC(C#N)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H16F3NO3/c1-12-4-3-5-13(2)17(12)24-11-23-16(10-22)14-6-8-15(9-7-14)25-18(19,20)21/h3-9,16H,11H2,1-2H3 |
| InChIKey | DFJOVKMIIKVVEN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,6-dimethylphenoxy)methoxy]-2-[4-(trifluoromethoxy)phenyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-dimethylphenoxy)methoxy]-2-[4-(trifluoromethoxy)phenyl]acetonitrile?
The IUPAC name of 2-[(2,6-dimethylphenoxy)methoxy]-2-[4-(trifluoromethoxy)phenyl]acetonitrile (CID 66940058) is 2-[(2,6-dimethylphenoxy)methoxy]-2-[4-(trifluoromethoxy)phenyl]acetonitrile.
What is the SMILES notation for 2-[(2,6-dimethylphenoxy)methoxy]-2-[4-(trifluoromethoxy)phenyl]acetonitrile?
The canonical SMILES for 2-[(2,6-dimethylphenoxy)methoxy]-2-[4-(trifluoromethoxy)phenyl]acetonitrile is Cc1cccc(C)c1OCOC(C#N)c1ccc(OC(F)(F)F)cc1.
What is the InChIKey of 2-[(2,6-dimethylphenoxy)methoxy]-2-[4-(trifluoromethoxy)phenyl]acetonitrile?
The InChIKey is DFJOVKMIIKVVEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F3NO3/c1-12-4-3-5-13(2)17(12)24-11-23-16(10-22)14-6-8-15(9-7-14)25-18(19,20)21/h3-9,16H,11H2,1-2H3.
What are the key properties of 2-[(2,6-dimethylphenoxy)methoxy]-2-[4-(trifluoromethoxy)phenyl]acetonitrile?
2-[(2,6-dimethylphenoxy)methoxy]-2-[4-(trifluoromethoxy)phenyl]acetonitrile has a molecular weight of 351.32 g/mol, XLogP of 4.82, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dimethylphenoxy)methoxy]-2-[4-(trifluoromethoxy)phenyl]acetonitrile is sourced from PubChem (CID 66940058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).