About CID 66941347
CID 66941347 (PubChem CID 66941347) has the molecular formula C26H42NOSi
and a molecular weight of 412.71 g/mol.
Molecular Properties
| Compound Name | CID 66941347 |
| PubChem CID | 66941347 |
| Molecular Formula | C26H42NOSi |
| Molecular Weight | 412.71 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | — |
| SMILES | CCCN(CCC)CCCc1ccc2cc(C(C)(C)C)ccc2c1CO[Si](C)C |
| InChI | InChI=1S/C26H42NOSi/c1-8-16-27(17-9-2)18-10-11-21-12-13-22-19-23(26(3,4)5)14-15-24(22)25(21)20-28-29(6)7/h12-15,19H,8-11,16-18,20H2,1-7H3 |
| InChIKey | CPYVZVWJLVCDMU-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.71 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66941347 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66941347?
The IUPAC name of CID 66941347 (CID 66941347) is not available.
What is the SMILES notation for CID 66941347?
The canonical SMILES for CID 66941347 is CCCN(CCC)CCCc1ccc2cc(C(C)(C)C)ccc2c1CO[Si](C)C.
What is the InChIKey of CID 66941347?
The InChIKey is CPYVZVWJLVCDMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H42NOSi/c1-8-16-27(17-9-2)18-10-11-21-12-13-22-19-23(26(3,4)5)14-15-24(22)25(21)20-28-29(6)7/h12-15,19H,8-11,16-18,20H2,1-7H3.
What are the key properties of CID 66941347?
CID 66941347 has a molecular weight of 412.71 g/mol, XLogP of 6.96, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66941347 is sourced from PubChem (CID 66941347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).