C11H11ClF3NO3 — CID 66941470
3-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-hydroxybutanoic acid (PubChem CID 66941470) has the molecular formula C11H11ClF3NO3 and a molecular weight of 297.66 g/mol. Its IUPAC name is 3-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-hydroxybutanoic acid.
| Compound Name | 3-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 66941470 |
| Molecular Formula | C11H11ClF3NO3 |
| Molecular Weight | 297.66 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 3-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-hydroxybutanoic acid |
| SMILES | CC(c1cc(Cl)c(N)c(C(F)(F)F)c1)C(O)C(=O)O |
| InChI | InChI=1S/C11H11ClF3NO3/c1-4(9(17)10(18)19)5-2-6(11(13,14)15)8(16)7(12)3-5/h2-4,9,17H,16H2,1H3,(H,18,19) |
| InChIKey | AUITYIJHRWGRSP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.66 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|