About [3-(5-acetyl-3-tert-butyl-2-methoxyphenoxy)-2,2-dimethylpropyl] acetate
[3-(5-acetyl-3-tert-butyl-2-methoxyphenoxy)-2,2-dimethylpropyl] acetate (PubChem CID 66941539) has the molecular formula C20H30O5
and a molecular weight of 350.46 g/mol. Its IUPAC name is [3-(5-acetyl-3-tert-butyl-2-methoxyphenoxy)-2,2-dimethylpropyl] acetate.
Molecular Properties
| Compound Name | [3-(5-acetyl-3-tert-butyl-2-methoxyphenoxy)-2,2-dimethylpropyl] acetate |
| PubChem CID | 66941539 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | [3-(5-acetyl-3-tert-butyl-2-methoxyphenoxy)-2,2-dimethylpropyl] acetate |
| SMILES | COc1c(OCC(C)(C)COC(C)=O)cc(C(C)=O)cc1C(C)(C)C |
| InChI | InChI=1S/C20H30O5/c1-13(21)15-9-16(19(3,4)5)18(23-8)17(10-15)25-12-20(6,7)11-24-14(2)22/h9-10H,11-12H2,1-8H3 |
| InChIKey | YAPYKQSMXIZTHS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(5-acetyl-3-tert-butyl-2-methoxyphenoxy)-2,2-dimethylpropyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5-acetyl-3-tert-butyl-2-methoxyphenoxy)-2,2-dimethylpropyl] acetate?
The IUPAC name of [3-(5-acetyl-3-tert-butyl-2-methoxyphenoxy)-2,2-dimethylpropyl] acetate (CID 66941539) is [3-(5-acetyl-3-tert-butyl-2-methoxyphenoxy)-2,2-dimethylpropyl] acetate.
What is the SMILES notation for [3-(5-acetyl-3-tert-butyl-2-methoxyphenoxy)-2,2-dimethylpropyl] acetate?
The canonical SMILES for [3-(5-acetyl-3-tert-butyl-2-methoxyphenoxy)-2,2-dimethylpropyl] acetate is COc1c(OCC(C)(C)COC(C)=O)cc(C(C)=O)cc1C(C)(C)C.
What is the InChIKey of [3-(5-acetyl-3-tert-butyl-2-methoxyphenoxy)-2,2-dimethylpropyl] acetate?
The InChIKey is YAPYKQSMXIZTHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O5/c1-13(21)15-9-16(19(3,4)5)18(23-8)17(10-15)25-12-20(6,7)11-24-14(2)22/h9-10H,11-12H2,1-8H3.
What are the key properties of [3-(5-acetyl-3-tert-butyl-2-methoxyphenoxy)-2,2-dimethylpropyl] acetate?
[3-(5-acetyl-3-tert-butyl-2-methoxyphenoxy)-2,2-dimethylpropyl] acetate has a molecular weight of 350.46 g/mol, XLogP of 4.16, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5-acetyl-3-tert-butyl-2-methoxyphenoxy)-2,2-dimethylpropyl] acetate is sourced from PubChem (CID 66941539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).