1-ethylpiperazin-2-one;2,2,2-trifluoroacetic acid

C8H13F3N2O3 — CID 66941853

IUPAC1-ethylpiperazin-2-one;2,2,2-trifluoroacetic acid
SMILESCCN1CCNCC1=O.O=C(O)C(F)(F)F
InChIInChI=1S/C6H12N2O.C2HF3O2/c1-2-8-4-3-7-5-6(8)9;3-2(4,5)1(6)7/h7H,2-5H2,1H3;(H,6,7)
InChIKeyFOAYJXQBVQIGJK-UHFFFAOYSA-N
MW242.20 g/mol
LogP0.07
Rot. Bonds1

About 1-ethylpiperazin-2-one;2,2,2-trifluoroacetic acid

1-ethylpiperazin-2-one;2,2,2-trifluoroacetic acid (PubChem CID 66941853) has the molecular formula C8H13F3N2O3 and a molecular weight of 242.20 g/mol. Its IUPAC name is 1-ethylpiperazin-2-one;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name1-ethylpiperazin-2-one;2,2,2-trifluoroacetic acid
PubChem CID66941853
Molecular FormulaC8H13F3N2O3
Molecular Weight242.20 g/mol
Exact Mass242.09
IUPAC Name1-ethylpiperazin-2-one;2,2,2-trifluoroacetic acid
SMILESCCN1CCNCC1=O.O=C(O)C(F)(F)F
InChIInChI=1S/C6H12N2O.C2HF3O2/c1-2-8-4-3-7-5-6(8)9;3-2(4,5)1(6)7/h7H,2-5H2,1H3;(H,6,7)
InChIKeyFOAYJXQBVQIGJK-UHFFFAOYSA-N
XLogP0.07
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.20
LogP ≤ 50.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 1-ethylpiperazin-2-one;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethylpiperazin-2-one;2,2,2-trifluoroacetic acid?
The IUPAC name of 1-ethylpiperazin-2-one;2,2,2-trifluoroacetic acid (CID 66941853) is 1-ethylpiperazin-2-one;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 1-ethylpiperazin-2-one;2,2,2-trifluoroacetic acid?
The canonical SMILES for 1-ethylpiperazin-2-one;2,2,2-trifluoroacetic acid is CCN1CCNCC1=O.O=C(O)C(F)(F)F.
What is the InChIKey of 1-ethylpiperazin-2-one;2,2,2-trifluoroacetic acid?
The InChIKey is FOAYJXQBVQIGJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.C2HF3O2/c1-2-8-4-3-7-5-6(8)9;3-2(4,5)1(6)7/h7H,2-5H2,1H3;(H,6,7).
What are the key properties of 1-ethylpiperazin-2-one;2,2,2-trifluoroacetic acid?
1-ethylpiperazin-2-one;2,2,2-trifluoroacetic acid has a molecular weight of 242.20 g/mol, XLogP of 0.07, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpiperazin-2-one;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 66941853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).