C11H15NS — CID 66941997
(3aR,9bS)-3a,4,5,7,8,9,9a,9b-octahydrothieno[2,3-c]quinoline (PubChem CID 66941997) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is (3aR,9bS)-3a,4,5,7,8,9,9a,9b-octahydrothieno[2,3-c]quinoline.
| Compound Name | (3aR,9bS)-3a,4,5,7,8,9,9a,9b-octahydrothieno[2,3-c]quinoline |
|---|---|
| PubChem CID | 66941997 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (3aR,9bS)-3a,4,5,7,8,9,9a,9b-octahydrothieno[2,3-c]quinoline |
| SMILES | C1=C[C@@H]2C3CCCC=C3NC[C@@H]2S1 |
| InChI | InChI=1S/C11H15NS/c1-2-4-10-8(3-1)9-5-6-13-11(9)7-12-10/h4-6,8-9,11-12H,1-3,7H2/t8?,9-,11+/m1/s1 |
| InChIKey | BWHXHIFYZVJPCL-SNZBGZMYSA-N |
| XLogP | 2.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |