C11H15NS — CID 66941998
1,2,3a,4,5,5a,6,7-octahydrothieno[2,3-c]quinoline (PubChem CID 66941998) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is 1,2,3a,4,5,5a,6,7-octahydrothieno[2,3-c]quinoline.
| Compound Name | 1,2,3a,4,5,5a,6,7-octahydrothieno[2,3-c]quinoline |
|---|---|
| PubChem CID | 66941998 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 1,2,3a,4,5,5a,6,7-octahydrothieno[2,3-c]quinoline |
| SMILES | C1=CC2=C3CCSC3CNC2CC1 |
| InChI | InChI=1S/C11H15NS/c1-2-4-10-8(3-1)9-5-6-13-11(9)7-12-10/h1,3,10-12H,2,4-7H2 |
| InChIKey | FMHARUAPMRFJOD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |