About amino 3-amino-1H-1,2,4-triazole-5-carboxylate
amino 3-amino-1H-1,2,4-triazole-5-carboxylate (PubChem CID 66941999) has the molecular formula C3H5N5O2
and a molecular weight of 143.11 g/mol. Its IUPAC name is amino 3-amino-1H-1,2,4-triazole-5-carboxylate.
Molecular Properties
| Compound Name | amino 3-amino-1H-1,2,4-triazole-5-carboxylate |
| PubChem CID | 66941999 |
| Molecular Formula | C3H5N5O2 |
| Molecular Weight | 143.11 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | amino 3-amino-1H-1,2,4-triazole-5-carboxylate |
| SMILES | NOC(=O)c1nc(N)n[nH]1 |
| InChI | InChI=1S/C3H5N5O2/c4-3-6-1(7-8-3)2(9)10-5/h5H2,(H3,4,6,7,8) |
| InChIKey | NRWBBYXZLGNRBM-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.11 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 3-amino-1H-1,2,4-triazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 3-amino-1H-1,2,4-triazole-5-carboxylate?
The IUPAC name of amino 3-amino-1H-1,2,4-triazole-5-carboxylate (CID 66941999) is amino 3-amino-1H-1,2,4-triazole-5-carboxylate.
What is the SMILES notation for amino 3-amino-1H-1,2,4-triazole-5-carboxylate?
The canonical SMILES for amino 3-amino-1H-1,2,4-triazole-5-carboxylate is NOC(=O)c1nc(N)n[nH]1.
What is the InChIKey of amino 3-amino-1H-1,2,4-triazole-5-carboxylate?
The InChIKey is NRWBBYXZLGNRBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N5O2/c4-3-6-1(7-8-3)2(9)10-5/h5H2,(H3,4,6,7,8).
What are the key properties of amino 3-amino-1H-1,2,4-triazole-5-carboxylate?
amino 3-amino-1H-1,2,4-triazole-5-carboxylate has a molecular weight of 143.11 g/mol, XLogP of -1.58, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for amino 3-amino-1H-1,2,4-triazole-5-carboxylate is sourced from PubChem (CID 66941999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).