About N-(4,5-dihydro-1,3-thiazol-2-yl)-3-methoxybenzamide
N-(4,5-dihydro-1,3-thiazol-2-yl)-3-methoxybenzamide (PubChem CID 669435) has the molecular formula C11H12N2O2S
and a molecular weight of 236.30 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-3-methoxybenzamide.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-3-methoxybenzamide |
| PubChem CID | 669435 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NC2=NCCS2)c1 |
| InChI | InChI=1S/C11H12N2O2S/c1-15-9-4-2-3-8(7-9)10(14)13-11-12-5-6-16-11/h2-4,7H,5-6H2,1H3,(H,12,13,14) |
| InChIKey | PJFRVUICGRPQMZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4,5-dihydro-1,3-thiazol-2-yl)-3-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1,3-thiazol-2-yl)-3-methoxybenzamide?
The IUPAC name of N-(4,5-dihydro-1,3-thiazol-2-yl)-3-methoxybenzamide (CID 669435) is N-(4,5-dihydro-1,3-thiazol-2-yl)-3-methoxybenzamide.
What is the SMILES notation for N-(4,5-dihydro-1,3-thiazol-2-yl)-3-methoxybenzamide?
The canonical SMILES for N-(4,5-dihydro-1,3-thiazol-2-yl)-3-methoxybenzamide is COc1cccc(C(=O)NC2=NCCS2)c1.
What is the InChIKey of N-(4,5-dihydro-1,3-thiazol-2-yl)-3-methoxybenzamide?
The InChIKey is PJFRVUICGRPQMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2S/c1-15-9-4-2-3-8(7-9)10(14)13-11-12-5-6-16-11/h2-4,7H,5-6H2,1H3,(H,12,13,14).
What are the key properties of N-(4,5-dihydro-1,3-thiazol-2-yl)-3-methoxybenzamide?
N-(4,5-dihydro-1,3-thiazol-2-yl)-3-methoxybenzamide has a molecular weight of 236.30 g/mol, XLogP of 1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1,3-thiazol-2-yl)-3-methoxybenzamide is sourced from PubChem (CID 669435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).