C24H25N5O3S2 — CID 66944438
[3-cyano-2-(3-thiophen-3-ylprop-2-enoylamino)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(1,3-dimethylpyrazol-4-yl)methyl]carbamate (PubChem CID 66944438) has the molecular formula C24H25N5O3S2 and a molecular weight of 495.63 g/mol. Its IUPAC name is [3-cyano-2-(3-thiophen-3-ylprop-2-enoylamino)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(1,3-dimethylpyrazol-4-yl)methyl]carbamate.
| Compound Name | [3-cyano-2-(3-thiophen-3-ylprop-2-enoylamino)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(1,3-dimethylpyrazol-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 66944438 |
| Molecular Formula | C24H25N5O3S2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | [3-cyano-2-(3-thiophen-3-ylprop-2-enoylamino)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(1,3-dimethylpyrazol-4-yl)methyl]carbamate |
| SMILES | Cc1nn(C)cc1CNC(=O)OCC1CCc2c(sc(NC(=O)C=Cc3ccsc3)c2C#N)C1 |
| InChI | InChI=1S/C24H25N5O3S2/c1-15-18(12-29(2)28-15)11-26-24(31)32-13-17-3-5-19-20(10-25)23(34-21(19)9-17)27-22(30)6-4-16-7-8-33-14-16/h4,6-8,12,14,17H,3,5,9,11,13H2,1-2H3,(H,26,31)(H,27,30) |
| InChIKey | AAORGNMLLORFPF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|