C26H39NO8 — CID 66944489
(2S)-3-[3,4-di(butanoyloxy)phenyl]-2-[2-(2,2-dimethylbutanoyloxy)propylamino]propanoic acid (PubChem CID 66944489) has the molecular formula C26H39NO8 and a molecular weight of 493.60 g/mol. Its IUPAC name is (2S)-3-[3,4-di(butanoyloxy)phenyl]-2-[2-(2,2-dimethylbutanoyloxy)propylamino]propanoic acid.
| Compound Name | (2S)-3-[3,4-di(butanoyloxy)phenyl]-2-[2-(2,2-dimethylbutanoyloxy)propylamino]propanoic acid |
|---|---|
| PubChem CID | 66944489 |
| Molecular Formula | C26H39NO8 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | (2S)-3-[3,4-di(butanoyloxy)phenyl]-2-[2-(2,2-dimethylbutanoyloxy)propylamino]propanoic acid |
| SMILES | CCCC(=O)Oc1ccc(C[C@H](NCC(C)OC(=O)C(C)(C)CC)C(=O)O)cc1OC(=O)CCC |
| InChI | InChI=1S/C26H39NO8/c1-7-10-22(28)34-20-13-12-18(15-21(20)35-23(29)11-8-2)14-19(24(30)31)27-16-17(4)33-25(32)26(5,6)9-3/h12-13,15,17,19,27H,7-11,14,16H2,1-6H3,(H,30,31)/t17?,19-/m0/s1 |
| InChIKey | ZLXLOBDWXFMYSS-NNBQYGFHSA-N |
| XLogP | 4.05 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|