C28H43NO10 — CID 66945354
(2S)-2-amino-3-[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]-4-methyl-5-propanoyloxyhexanoic acid (PubChem CID 66945354) has the molecular formula C28H43NO10 and a molecular weight of 553.65 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]-4-methyl-5-propanoyloxyhexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]-4-methyl-5-propanoyloxyhexanoic acid |
|---|---|
| PubChem CID | 66945354 |
| Molecular Formula | C28H43NO10 |
| Molecular Weight | 553.65 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]-4-methyl-5-propanoyloxyhexanoic acid |
| SMILES | CCC(=O)OC(C)C(C)C(c1ccc(OC(=O)OC(C)(C)CC)c(OC(=O)OC(C)(C)CC)c1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C28H43NO10/c1-10-21(30)35-17(5)16(4)22(23(29)24(31)32)18-13-14-19(36-25(33)38-27(6,7)11-2)20(15-18)37-26(34)39-28(8,9)12-3/h13-17,22-23H,10-12,29H2,1-9H3,(H,31,32)/t16?,17?,22?,23-/m0/s1 |
| InChIKey | JQTNKQTURBTRGP-MFVBDYKBSA-N |
| XLogP | 5.57 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.65 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|