C12H19F3N4O4 — CID 66950856
(2S)-2-amino-3,3-dimethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]butanamide;2,2,2-trifluoroacetic acid (PubChem CID 66950856) has the molecular formula C12H19F3N4O4 and a molecular weight of 340.30 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]butanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-amino-3,3-dimethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]butanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66950856 |
| Molecular Formula | C12H19F3N4O4 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]butanamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CNC(=O)[C@@H](N)C(C)(C)C)no1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H18N4O2.C2HF3O2/c1-6-13-7(14-16-6)5-12-9(15)8(11)10(2,3)4;3-2(4,5)1(6)7/h8H,5,11H2,1-4H3,(H,12,15);(H,6,7)/t8-;/m1./s1 |
| InChIKey | NTDNBPHNQJTPBE-DDWIOCJRSA-N |
| XLogP | 1.00 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |