C19H23FN6O3 — CID 66952490
(3R,5R)-4-amino-1-[[4-(4-fluoro-3-methoxyanilino)pyrrolo[2,1-f][1,2,4]triazin-5-yl]methyl]piperidine-3,5-diol (PubChem CID 66952490) has the molecular formula C19H23FN6O3 and a molecular weight of 402.43 g/mol. Its IUPAC name is (3R,5R)-4-amino-1-[[4-(4-fluoro-3-methoxyanilino)pyrrolo[2,1-f][1,2,4]triazin-5-yl]methyl]piperidine-3,5-diol.
| Compound Name | (3R,5R)-4-amino-1-[[4-(4-fluoro-3-methoxyanilino)pyrrolo[2,1-f][1,2,4]triazin-5-yl]methyl]piperidine-3,5-diol |
|---|---|
| PubChem CID | 66952490 |
| Molecular Formula | C19H23FN6O3 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (3R,5R)-4-amino-1-[[4-(4-fluoro-3-methoxyanilino)pyrrolo[2,1-f][1,2,4]triazin-5-yl]methyl]piperidine-3,5-diol |
| SMILES | COc1cc(Nc2ncnn3ccc(CN4C[C@@H](O)C(N)[C@H](O)C4)c23)ccc1F |
| InChI | InChI=1S/C19H23FN6O3/c1-29-16-6-12(2-3-13(16)20)24-19-18-11(4-5-26(18)23-10-22-19)7-25-8-14(27)17(21)15(28)9-25/h2-6,10,14-15,17,27-28H,7-9,21H2,1H3,(H,22,23,24)/t14-,15-/m1/s1 |
| InChIKey | HLXBYPFCHOFLKX-HUUCEWRRSA-N |
| XLogP | 0.49 |
| TPSA | 121.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |