C23H29N3O3 — CID 66952603
2-(oxan-2-ylamino)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide (PubChem CID 66952603) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 2-(oxan-2-ylamino)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide.
| Compound Name | 2-(oxan-2-ylamino)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide |
|---|---|
| PubChem CID | 66952603 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 2-(oxan-2-ylamino)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide |
| SMILES | Cc1cn(-c2ccc(C(N)=O)c(NC3CCCCO3)c2)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C23H29N3O3/c1-14-13-26(18-11-23(2,3)12-19(27)21(14)18)15-7-8-16(22(24)28)17(10-15)25-20-6-4-5-9-29-20/h7-8,10,13,20,25H,4-6,9,11-12H2,1-3H3,(H2,24,28) |
| InChIKey | ZNGLVZSAVGEPLJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |