C23H30N4O4 — CID 66952622
2-[[(3S,4R)-3,4-dihydroxycyclohexyl]amino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide (PubChem CID 66952622) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-[[(3S,4R)-3,4-dihydroxycyclohexyl]amino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide.
| Compound Name | 2-[[(3S,4R)-3,4-dihydroxycyclohexyl]amino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide |
|---|---|
| PubChem CID | 66952622 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 2-[[(3S,4R)-3,4-dihydroxycyclohexyl]amino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide |
| SMILES | Cc1nn(-c2ccc(C(N)=O)c(NC3CC[C@@H](O)[C@@H](O)C3)c2)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C23H30N4O4/c1-12-21-17(10-23(2,3)11-20(21)30)27(26-12)14-5-6-15(22(24)31)16(9-14)25-13-4-7-18(28)19(29)8-13/h5-6,9,13,18-19,25,28-29H,4,7-8,10-11H2,1-3H3,(H2,24,31)/t13?,18-,19+/m1/s1 |
| InChIKey | OSAKLQPFSOFTBK-ZOIVMXBYSA-N |
| XLogP | 2.12 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |