2-(thieno[3,2-b]pyridine-5-carbonylamino)acetic acid

C10H8N2O3S — CID 66952658

IUPAC2-(thieno[3,2-b]pyridine-5-carbonylamino)acetic acid
SMILESO=C(O)CNC(=O)c1ccc2sccc2n1
InChIInChI=1S/C10H8N2O3S/c13-9(14)5-11-10(15)7-1-2-8-6(12-7)3-4-16-8/h1-4H,5H2,(H,11,15)(H,13,14)
InChIKeyUFJCGKQMYXLSIO-UHFFFAOYSA-N
MW236.25 g/mol
LogP1.11
Rot. Bonds3

About 2-(thieno[3,2-b]pyridine-5-carbonylamino)acetic acid

2-(thieno[3,2-b]pyridine-5-carbonylamino)acetic acid (PubChem CID 66952658) has the molecular formula C10H8N2O3S and a molecular weight of 236.25 g/mol. Its IUPAC name is 2-(thieno[3,2-b]pyridine-5-carbonylamino)acetic acid.

Molecular Properties

Compound Name2-(thieno[3,2-b]pyridine-5-carbonylamino)acetic acid
PubChem CID66952658
Molecular FormulaC10H8N2O3S
Molecular Weight236.25 g/mol
Exact Mass236.03
IUPAC Name2-(thieno[3,2-b]pyridine-5-carbonylamino)acetic acid
SMILESO=C(O)CNC(=O)c1ccc2sccc2n1
InChIInChI=1S/C10H8N2O3S/c13-9(14)5-11-10(15)7-1-2-8-6(12-7)3-4-16-8/h1-4H,5H2,(H,11,15)(H,13,14)
InChIKeyUFJCGKQMYXLSIO-UHFFFAOYSA-N
XLogP1.11
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.25
LogP ≤ 51.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(thieno[3,2-b]pyridine-5-carbonylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(thieno[3,2-b]pyridine-5-carbonylamino)acetic acid?
The IUPAC name of 2-(thieno[3,2-b]pyridine-5-carbonylamino)acetic acid (CID 66952658) is 2-(thieno[3,2-b]pyridine-5-carbonylamino)acetic acid.
What is the SMILES notation for 2-(thieno[3,2-b]pyridine-5-carbonylamino)acetic acid?
The canonical SMILES for 2-(thieno[3,2-b]pyridine-5-carbonylamino)acetic acid is O=C(O)CNC(=O)c1ccc2sccc2n1.
What is the InChIKey of 2-(thieno[3,2-b]pyridine-5-carbonylamino)acetic acid?
The InChIKey is UFJCGKQMYXLSIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3S/c13-9(14)5-11-10(15)7-1-2-8-6(12-7)3-4-16-8/h1-4H,5H2,(H,11,15)(H,13,14).
What are the key properties of 2-(thieno[3,2-b]pyridine-5-carbonylamino)acetic acid?
2-(thieno[3,2-b]pyridine-5-carbonylamino)acetic acid has a molecular weight of 236.25 g/mol, XLogP of 1.11, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(thieno[3,2-b]pyridine-5-carbonylamino)acetic acid is sourced from PubChem (CID 66952658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).