C23H24N4O2 — CID 66952813
2-(pyridin-4-ylamino)-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide (PubChem CID 66952813) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-(pyridin-4-ylamino)-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide.
| Compound Name | 2-(pyridin-4-ylamino)-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide |
|---|---|
| PubChem CID | 66952813 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-(pyridin-4-ylamino)-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide |
| SMILES | Cc1cc2c(n1-c1ccc(C(N)=O)c(Nc3ccncc3)c1)CC(C)(C)CC2=O |
| InChI | InChI=1S/C23H24N4O2/c1-14-10-18-20(12-23(2,3)13-21(18)28)27(14)16-4-5-17(22(24)29)19(11-16)26-15-6-8-25-9-7-15/h4-11H,12-13H2,1-3H3,(H2,24,29)(H,25,26) |
| InChIKey | FFGAZJOPPFAMIA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|