C23H30N2O4 — CID 66952977
3-(2-propan-2-yloxyethoxy)-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide (PubChem CID 66952977) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 3-(2-propan-2-yloxyethoxy)-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide.
| Compound Name | 3-(2-propan-2-yloxyethoxy)-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide |
|---|---|
| PubChem CID | 66952977 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 3-(2-propan-2-yloxyethoxy)-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide |
| SMILES | Cc1cc2c(n1-c1ccc(C(N)=O)cc1OCCOC(C)C)CC(C)(C)CC2=O |
| InChI | InChI=1S/C23H30N2O4/c1-14(2)28-8-9-29-21-11-16(22(24)27)6-7-18(21)25-15(3)10-17-19(25)12-23(4,5)13-20(17)26/h6-7,10-11,14H,8-9,12-13H2,1-5H3,(H2,24,27) |
| InChIKey | ICRMAMXQRQMIOD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|