C25H25F2N3O3 — CID 66953048
2-[4-(difluoromethoxy)anilino]-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide (PubChem CID 66953048) has the molecular formula C25H25F2N3O3 and a molecular weight of 453.49 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)anilino]-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide.
| Compound Name | 2-[4-(difluoromethoxy)anilino]-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide |
|---|---|
| PubChem CID | 66953048 |
| Molecular Formula | C25H25F2N3O3 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 2-[4-(difluoromethoxy)anilino]-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide |
| SMILES | Cc1cc2c(n1-c1ccc(C(N)=O)c(Nc3ccc(OC(F)F)cc3)c1)CC(C)(C)CC2=O |
| InChI | InChI=1S/C25H25F2N3O3/c1-14-10-19-21(12-25(2,3)13-22(19)31)30(14)16-6-9-18(23(28)32)20(11-16)29-15-4-7-17(8-5-15)33-24(26)27/h4-11,24,29H,12-13H2,1-3H3,(H2,28,32) |
| InChIKey | XUSVHBDKMJUZQY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|