About 2-pentyl-1H-imidazole-4,5-dicarbonitrile
2-pentyl-1H-imidazole-4,5-dicarbonitrile (PubChem CID 66953159) has the molecular formula C10H12N4
and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-pentyl-1H-imidazole-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-pentyl-1H-imidazole-4,5-dicarbonitrile |
| PubChem CID | 66953159 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 2-pentyl-1H-imidazole-4,5-dicarbonitrile |
| SMILES | CCCCCc1nc(C#N)c(C#N)[nH]1 |
| InChI | InChI=1S/C10H12N4/c1-2-3-4-5-10-13-8(6-11)9(7-12)14-10/h2-5H2,1H3,(H,13,14) |
| InChIKey | LXLXXFXPBMQUIS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentyl-1H-imidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentyl-1H-imidazole-4,5-dicarbonitrile?
The IUPAC name of 2-pentyl-1H-imidazole-4,5-dicarbonitrile (CID 66953159) is 2-pentyl-1H-imidazole-4,5-dicarbonitrile.
What is the SMILES notation for 2-pentyl-1H-imidazole-4,5-dicarbonitrile?
The canonical SMILES for 2-pentyl-1H-imidazole-4,5-dicarbonitrile is CCCCCc1nc(C#N)c(C#N)[nH]1.
What is the InChIKey of 2-pentyl-1H-imidazole-4,5-dicarbonitrile?
The InChIKey is LXLXXFXPBMQUIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4/c1-2-3-4-5-10-13-8(6-11)9(7-12)14-10/h2-5H2,1H3,(H,13,14).
What are the key properties of 2-pentyl-1H-imidazole-4,5-dicarbonitrile?
2-pentyl-1H-imidazole-4,5-dicarbonitrile has a molecular weight of 188.23 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentyl-1H-imidazole-4,5-dicarbonitrile is sourced from PubChem (CID 66953159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).