C33H45F3N6O5 — CID 66953901
8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrol-1-yl)-1-[2-(1-adamantyl)-2-oxoethyl]-3-cyclopropyl-7-(3-methylbutyl)purine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 66953901) has the molecular formula C33H45F3N6O5 and a molecular weight of 662.75 g/mol. Its IUPAC name is 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrol-1-yl)-1-[2-(1-adamantyl)-2-oxoethyl]-3-cyclopropyl-7-(3-methylbutyl)purine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrol-1-yl)-1-[2-(1-adamantyl)-2-oxoethyl]-3-cyclopropyl-7-(3-methylbutyl)purine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66953901 |
| Molecular Formula | C33H45F3N6O5 |
| Molecular Weight | 662.75 g/mol |
| Exact Mass | 662.34 |
| IUPAC Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrol-1-yl)-1-[2-(1-adamantyl)-2-oxoethyl]-3-cyclopropyl-7-(3-methylbutyl)purine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)CCn1c(N2CCC3CNCC32)nc2c1c(=O)n(CC(=O)C13CC4CC(CC(C4)C1)C3)c(=O)n2C1CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H44N6O3.C2HF3O2/c1-18(2)5-7-35-26-27(33-29(35)34-8-6-22-15-32-16-24(22)34)37(23-3-4-23)30(40)36(28(26)39)17-25(38)31-12-19-9-20(13-31)11-21(10-19)14-31;3-2(4,5)1(6)7/h18-24,32H,3-17H2,1-2H3;(H,6,7) |
| InChIKey | NDIHGUAOFUJWFL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 131.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.75 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |