C23H30F3N7O5 — CID 66954002
8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-3-methyl-1-(3-methylbutyl)-7-(1,3-oxazol-2-ylmethyl)purine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 66954002) has the molecular formula C23H30F3N7O5 and a molecular weight of 541.53 g/mol. Its IUPAC name is 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-3-methyl-1-(3-methylbutyl)-7-(1,3-oxazol-2-ylmethyl)purine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-3-methyl-1-(3-methylbutyl)-7-(1,3-oxazol-2-ylmethyl)purine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66954002 |
| Molecular Formula | C23H30F3N7O5 |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 8-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-3-methyl-1-(3-methylbutyl)-7-(1,3-oxazol-2-ylmethyl)purine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)CCn1c(=O)c2c(nc(N3CCC4CNCC43)n2Cc2ncco2)n(C)c1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H29N7O3.C2HF3O2/c1-13(2)4-7-27-19(29)17-18(25(3)21(27)30)24-20(28(17)12-16-23-6-9-31-16)26-8-5-14-10-22-11-15(14)26;3-2(4,5)1(6)7/h6,9,13-15,22H,4-5,7-8,10-12H2,1-3H3;(H,6,7) |
| InChIKey | BVWWBJOFUOUFBR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 140.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |