C26H32N6O3 — CID 66954220
8-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-phenacylpurine-2,6-dione (PubChem CID 66954220) has the molecular formula C26H32N6O3 and a molecular weight of 476.58 g/mol. Its IUPAC name is 8-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-phenacylpurine-2,6-dione.
| Compound Name | 8-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-phenacylpurine-2,6-dione |
|---|---|
| PubChem CID | 66954220 |
| Molecular Formula | C26H32N6O3 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 8-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-phenacylpurine-2,6-dione |
| SMILES | CC(C)=CCn1c(N2CC3CCCNC3C2)nc2c1c(=O)n(CC(=O)c1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C26H32N6O3/c1-17(2)11-13-31-22-23(28-25(31)30-14-19-10-7-12-27-20(19)15-30)29(3)26(35)32(24(22)34)16-21(33)18-8-5-4-6-9-18/h4-6,8-9,11,19-20,27H,7,10,12-16H2,1-3H3 |
| InChIKey | QACNBVKYHZLWBU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 94.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|