C26H28N6O5S — CID 66954332
5-[[[[(3R,4S)-4-hydroxypyrrolidin-3-yl]-(6-methoxy-1,5-naphthyridin-4-yl)methyl]amino]methyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one (PubChem CID 66954332) has the molecular formula C26H28N6O5S and a molecular weight of 536.61 g/mol. Its IUPAC name is 5-[[[[(3R,4S)-4-hydroxypyrrolidin-3-yl]-(6-methoxy-1,5-naphthyridin-4-yl)methyl]amino]methyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one.
| Compound Name | 5-[[[[(3R,4S)-4-hydroxypyrrolidin-3-yl]-(6-methoxy-1,5-naphthyridin-4-yl)methyl]amino]methyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 66954332 |
| Molecular Formula | C26H28N6O5S |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | 5-[[[[(3R,4S)-4-hydroxypyrrolidin-3-yl]-(6-methoxy-1,5-naphthyridin-4-yl)methyl]amino]methyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
| SMILES | COc1ccc2nccc(C(NCC3CN(c4ccc5c(c4)NC(=O)CS5)C(=O)O3)[C@H]3CNC[C@H]3O)c2n1 |
| InChI | InChI=1S/C26H28N6O5S/c1-36-23-5-3-18-25(31-23)16(6-7-28-18)24(17-10-27-11-20(17)33)29-9-15-12-32(26(35)37-15)14-2-4-21-19(8-14)30-22(34)13-38-21/h2-8,15,17,20,24,27,29,33H,9-13H2,1H3,(H,30,34)/t15?,17-,20+,24?/m0/s1 |
| InChIKey | SUKXZRIERWQSKL-SZCOSJAVSA-N |
| XLogP | 1.92 |
| TPSA | 137.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |