C27H32N6O3 — CID 66954338
5-[[4-(6-methoxy-1,5-naphthyridin-4-yl)piperazin-1-yl]methyl]-3-(4-pyrrolidin-1-ylphenyl)-1,3-oxazolidin-2-one (PubChem CID 66954338) has the molecular formula C27H32N6O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is 5-[[4-(6-methoxy-1,5-naphthyridin-4-yl)piperazin-1-yl]methyl]-3-(4-pyrrolidin-1-ylphenyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-[[4-(6-methoxy-1,5-naphthyridin-4-yl)piperazin-1-yl]methyl]-3-(4-pyrrolidin-1-ylphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 66954338 |
| Molecular Formula | C27H32N6O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 5-[[4-(6-methoxy-1,5-naphthyridin-4-yl)piperazin-1-yl]methyl]-3-(4-pyrrolidin-1-ylphenyl)-1,3-oxazolidin-2-one |
| SMILES | COc1ccc2nccc(N3CCN(CC4CN(c5ccc(N6CCCC6)cc5)C(=O)O4)CC3)c2n1 |
| InChI | InChI=1S/C27H32N6O3/c1-35-25-9-8-23-26(29-25)24(10-11-28-23)32-16-14-30(15-17-32)18-22-19-33(27(34)36-22)21-6-4-20(5-7-21)31-12-2-3-13-31/h4-11,22H,2-3,12-19H2,1H3 |
| InChIKey | GJDASPGBTVMSQC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|