About 2,3,5-triphenylporphyrin
2,3,5-triphenylporphyrin (PubChem CID 66954634) has the molecular formula C38H24N4
and a molecular weight of 536.64 g/mol. Its IUPAC name is 2,3,5-triphenylporphyrin.
Molecular Properties
| Compound Name | 2,3,5-triphenylporphyrin |
| PubChem CID | 66954634 |
| Molecular Formula | C38H24N4 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 2,3,5-triphenylporphyrin |
| SMILES | C1=C/C2=C/C3=N/C(=C\C4=N/C(=C(/c5ccccc5)C5=N/C(=C\C1=N2)C=C5)C(c1ccccc1)=C4c1ccccc1)C=C3 |
| InChI | InChI=1S/C38H24N4/c1-4-10-25(11-5-1)35-34-24-32-19-18-29(40-32)22-28-16-17-30(39-28)23-31-20-21-33(41-31)36(26-12-6-2-7-13-26)38(42-34)37(35)27-14-8-3-9-15-27/h1-24H/b28-22-,29-22-,30-23-,31-23-,32-24-,34-24-,36-33-,38-36- |
| InChIKey | RWHPKOSXVGRIKD-ATZQJCMFSA-N |
| XLogP | 8.16 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2,3,5-triphenylporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5-triphenylporphyrin?
The IUPAC name of 2,3,5-triphenylporphyrin (CID 66954634) is 2,3,5-triphenylporphyrin.
What is the SMILES notation for 2,3,5-triphenylporphyrin?
The canonical SMILES for 2,3,5-triphenylporphyrin is C1=C/C2=C/C3=N/C(=C\C4=N/C(=C(/c5ccccc5)C5=N/C(=C\C1=N2)C=C5)C(c1ccccc1)=C4c1ccccc1)C=C3.
What is the InChIKey of 2,3,5-triphenylporphyrin?
The InChIKey is RWHPKOSXVGRIKD-ATZQJCMFSA-N. The full InChI is InChI=1S/C38H24N4/c1-4-10-25(11-5-1)35-34-24-32-19-18-29(40-32)22-28-16-17-30(39-28)23-31-20-21-33(41-31)36(26-12-6-2-7-13-26)38(42-34)37(35)27-14-8-3-9-15-27/h1-24H/b28-22-,29-22-,30-23-,31-23-,32-24-,34-24-,36-33-,38-36-.
What are the key properties of 2,3,5-triphenylporphyrin?
2,3,5-triphenylporphyrin has a molecular weight of 536.64 g/mol, XLogP of 8.16, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5-triphenylporphyrin is sourced from PubChem (CID 66954634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).